Chemical Properties | Back Directory | [storage temp. ]
2-8°C, sealed storage, away from moisture and light | [solubility ]
Soluble in water, DMF, DMSO, alcohols | [form ]
Solid | [color ]
Brown to reddish brown | [Appearance]
Dark blue solid | [ex/em]
649/672 nm (PBS buffer) | [ε(extinction coefficient)]
271000 L?mol?1?cm?1 | [Φ(quantum yield)]
0.28 | [InChIKey]
YAAUASLQACUDFY-UHFFFAOYSA-N | [SMILES]
C([N+]1=C(C(C)(C)C2=CC(S([O-])(=O)=O)=CC=C12)C=CC=CC=C1N(C2=CC=C(S(O)(=O)=O)C=C2C1(C)C)C)CCCCC(=O)NCCCCCCN |
Hazard Information | Back Directory | [Description]
Sulfo-Cy5 amine is a water-soluble dye that reacts with electrophilic substances and is very photostable. The addition of the amine group makes the compound reactive towards carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. | [Uses]
Sulfo-Cy5 amine is a dye derivative of Cyanine 5 (Cy5) (HY-D0821) bearing an amine group. The sulfonate ion increases the water solubility of the compound, making it suitable for use in aqueous solutions. Cy5 is a near-infrared fluorescent dye commonly used in biolabeling and cell imaging. The amine functionality of Sulfo-Cy5 amine can react with carboxyl groups to form covalent bonds. Sulfo-Cy5 amine can bind to biomolecules such as proteins and antibodies to track their location and dynamic changes in biological samples. | [Abs/Em Maxima]
646/662 nm | [Fluoresene quantum yield]
0.28 | [Extinction Coefficient]
271000 | [CF260]
0.04 | [CF280]
0.04 |
|
|