4-Isopropylpyridine Diphenylmethylboronate manufacturers
|
| | 4-Isopropylpyridine Diphenylmethylboronate Basic information |
| Product Name: | 4-Isopropylpyridine Diphenylmethylboronate | | Synonyms: | 4-Isopropylpyridine diphenylMethylboronate;(diphenylmethyl)boronic acid;Benzhydrylboronic acid,4-propan-2-ylpyridine;(4-ISOPROPYLPYRIDINO)METHYLDIPHENYLBORANE;4-Isopropylpyridine diphenylMethylboronate (KM-2) | | CAS: | 159565-88-5 | | MF: | C21H24BNO2 | | MW: | 333.23176 | | EINECS: | | | Product Categories: | | | Mol File: | 159565-88-5.mol |  |
| | 4-Isopropylpyridine Diphenylmethylboronate Chemical Properties |
| InChI | InChI=1S/C13H13BO2.C8H11N/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-7(2)8-3-5-9-6-4-8/h1-10,13,15-16H;3-7H,1-2H3 | | InChIKey | VJTMUTCASDCLDK-UHFFFAOYSA-N | | SMILES | C1N=CC=C(C(C)C)C=1.C(C1=CC=CC=C1)(C1=CC=CC=C1)B(O)O |
| | 4-Isopropylpyridine Diphenylmethylboronate Usage And Synthesis |
| Uses |
4-Isopropylpyridine Diphenylmethylboronate is a new type of bactericide and algaecide. It is a broad-spectrum bactericide that can be used in marine ship coatings to prevent algae and other microorganisms from growing and adsorbing around the bottom of the ship. It has no toxic side effects on marine life and can protect ships without polluting the ocean. In addition, this product can also be used to protect facilities in other water bodies (such as marine power poles, bridge piers, docks, etc.) and other sterilization aspects.
|
| | 4-Isopropylpyridine Diphenylmethylboronate Preparation Products And Raw materials |
|