- 4-Amino-3-chlorophenol
-
- $0.00 / 1Kg/Bag
-
2025-04-30
- CAS:17609-80-2
- Min. Order: 1KG
- Purity: 99%min
- Supply Ability: 500KGS
- 4-Amino-3-Chlorophenol
-
- $10.00 / 1kg
-
2025-04-30
- CAS:17609-80-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20 ton
|
| | 4-Amino-3-chlorophenol Basic information |
| Product Name: | 4-Amino-3-chlorophenol | | Synonyms: | AMINO(4-)-3-CHLOROPHENOL;4-AMINO-3-CHLOROPHENOL;Brn 2802558;Einecs 241-583-3;Phenol, 4-amino-3-chloro-;lenvaint-G;lenvatinib intermediate;synthesis-023 | | CAS: | 17609-80-2 | | MF: | C6H6ClNO | | MW: | 143.57 | | EINECS: | 241-583-3 | | Product Categories: | 17609-80-2 | | Mol File: | 17609-80-2.mol |  |
| | 4-Amino-3-chlorophenol Chemical Properties |
| Melting point | 159-160℃ | | Boiling point | 287.3±25.0 °C(Predicted) | | density | 1.406±0.06 g/cm3(Predicted) | | RTECS | SJ5710000 | | storage temp. | 2-8°C(protect from light) | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Crystalline Powder | | pka | 9.26±0.18(Predicted) | | color | White | | Stability: | Hygroscopic | | InChI | InChI=1S/C6H6ClNO/c7-5-3-4(9)1-2-6(5)8/h1-3,9H,8H2 | | InChIKey | PNLPXABQLXSICH-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(N)C(Cl)=C1 | | CAS DataBase Reference | 17609-80-2(CAS DataBase Reference) |
| HazardClass | 6.1 | | HS Code | 2922290090 |
| | 4-Amino-3-chlorophenol Usage And Synthesis |
| Chemical Properties | Light yellow solid | | Uses | 4-Amino-3-Chlorophenol acts as a synthetic reagent for the preparation of Benzothiazole-based ureas as potential ABAD/17β-HSD10 modulators for Alzheimer''s disease treatment. | | Application | The 4-amino-3-chlorophenol is a crucial intermediate for preparing a tyrosine kinase inhibitor, tivozanib, and a late liver cancer drug, lenvatinib. As a crucial pharmaceutical chemical intermediate, 4-amino-3-chlorophenol is widely applied to the design and synthesis of medicaments for resisting tumors, cardiovascular diseases, neurological diseases, and the like. | | Synthesis | Starting from o-chloronitrobenzene with introducing hydroxyl groups in the presence of strong acids and molybdenum salts as catalysts could synthesize 4-amino-3-chlorophenol. Besides, using m-chlorophenol as a starting material and introducing hydroxyl on a benzene ring through diazotization and coupling also could synthesize 4-Amino-3-chlorophenol. |
| | 4-Amino-3-chlorophenol Preparation Products And Raw materials |
|