- 3-Indoleformic acid
-
- $30.00 / 1kg
-
2025-04-28
- CAS:771-50-6
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 100 tons
|
| | Indole-3-carboxylic acid Basic information |
| | Indole-3-carboxylic acid Chemical Properties |
| Melting point | 232-234 °C (dec.)(lit.) | | Boiling point | 287.44°C (rough estimate) | | density | 1.2480 (rough estimate) | | refractive index | 1.5050 (estimate) | | storage temp. | 2-8°C | | solubility | Soluble in 95% Ethanol: 50 mg/ml, also soluble in methanol. | | form | Powder | | pka | 3.90±0.10(Predicted) | | color | Light beige | | BRN | 129435 | | InChI | InChI=1S/C9H7NO2/c11-9(12)7-5-10-8-4-2-1-3-6(7)8/h1-5,10H,(H,11,12) | | InChIKey | KMAKOBLIOCQGJP-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C(C(O)=O)=C1 | | CAS DataBase Reference | 771-50-6(CAS DataBase Reference) |
| | Indole-3-carboxylic acid Usage And Synthesis |
| Chemical Properties | light beige crystalline powder (recrystallized from acetate-petroleum ether). Soluble in ethanol, ether, acetate, insoluble in boiling water, benzene, insoluble in petroleum ether. | | Application | Indole-3-carboxylic Acid is a specific and competitive inhibitor of the potentiation of glycine of NMDA-gated current. Chemical reagent in the synthesis of thiadiazole derivatives used for anticancer activity. | | Preparation | indole-3-carboxylic acid can be synthesized by the hydrolysis reaction of 3-trichloroacetyl indole: add 235g 3-trichloroacetyl indole into 1000ml methanol, slowly drop an appropriate amount of 50% KOH solution, heat up and reflux for 18 hours, cool to room temperature, The methanol was recovered by concentration, and the residual liquid was left; 1500 ml of water was added to the residual liquid, hydrochloric acid was added dropwise to adjust pH=3～4, and then filtered, and the solid obtained by filtration was dried to obtain 144g of indole-3-carboxylic acid crude product; The crude product was slurried with 100g of ethyl acetate for 25 minutes,filtered and dried to obtain indole-3-carboxylic acid (137g, yield 91.8%). | | Definition | ChEBI: Indole-3-carboxylic acid is an indole-3-carboxylic acid carrying a carboxy group at position 3. It has a role as a human metabolite and a bacterial metabolite. It is a conjugate acid of an indole-3-carboxylate. | | General Description | The structures of the derivatives of indole-3-carboxylic acid were studied using gas chromatography with high resolution mass spectrometry (GC-HRMS), ultra-high performance liquid chromatography in combination with high resolution tandem mass spectrometry (UHPLC-HRMS), nuclear magnetic resonance spectroscopy (NMR) and Fourier transform infrared spectroscopy (FT-IR). | | target | 5-HT Receptor |
| | Indole-3-carboxylic acid Preparation Products And Raw materials |
|