4-Ethylphenyl Acetate manufacturers
|
| | 4-Ethylphenyl Acetate Basic information |
| Product Name: | 4-Ethylphenyl Acetate | | Synonyms: | ACETIC ACID 4-ETHYLPHENYL ESTER;4-ETHYLPHENYL ACETATE;4-ethyl-phenoacetate;Phenol,4-ethyl-,acetate;ETHYL-4-PHENYL-MONO ACETATE;(4-ethylphenyl) ethanoate;p-ethylphenyl acetate;aceticacid4-ethylphenylester96+% | | CAS: | 3245-23-6 | | MF: | C10H12O2 | | MW: | 164.2 | | EINECS: | 221-818-6 | | Product Categories: | Organics | | Mol File: | 3245-23-6.mol |  |
| | 4-Ethylphenyl Acetate Chemical Properties |
| Boiling point | 226 °C | | density | 1.03 | | refractive index | 1.4980-1.5000 | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C10H12O2/c1-3-9-4-6-10(7-5-9)12-8(2)11/h4-7H,3H2,1-2H3 | | InChIKey | ANMYMLIUCWWISO-UHFFFAOYSA-N | | SMILES | C1(OC(=O)C)=CC=C(CC)C=C1 | | LogP | 2.560 | | CAS DataBase Reference | 3245-23-6(CAS DataBase Reference) | | EPA Substance Registry System | Phenol, 4-ethyl-, acetate (3245-23-6) |
| | 4-Ethylphenyl Acetate Usage And Synthesis |
| Chemical Properties | Acetic acid 4-ethylphenyl ester is a colorless liquid. Very slightly soluble in water,
soluble in alcohol and oils. Harsh-anisic, rather powerful odor with
sweet and somewhat floral character in higher
dilution. | | Uses | Acetic acid 4-ethylphenyl ester has been suggested for use in perfume
compositions, but this material does not have
much to offer to the perfumer. The overall
odor and performance is rather unattractive
and pungent, and only mere traces can be
useful in certain types of Cananga or Ylang-Ylang bases, etc | | Preparation | By Acetylation of para-Ethyl phenol
with Acetic anhydride. |
| | 4-Ethylphenyl Acetate Preparation Products And Raw materials |
|