|
|
| | 4-Hydroxy-2-(methylthio)pyrimidine-5-carbonitrile Basic information |
| Product Name: | 4-Hydroxy-2-(methylthio)pyrimidine-5-carbonitrile | | Synonyms: | 4-Hydroxy-2-(methylthio)pyrimidine-5-carbonitrile ,97%;5-Cyano-4-hydroxy-2-(methylthio)pyrimidine;4-hydroxy-2-(methylthio)pyrimidine-5-carbonitrile;5-Cyano-2-(Methylthio)pyriMidine-4-one;4-Hydroxy-2-Methylsulfanyl-pyriMidine-5-carbonitrile;5-Cyano-3,4-dihydro-2-methylthiopyrimidin-4-one;2-(Methylthio)-6-oxo-1,6-dihydropyriMidine-5-carbonitrile;2-(methylthio)-4-oxo-1,4-dihydropyrimidine-5-carbonitrile | | CAS: | 89487-99-0 | | MF: | C6H5N3OS | | MW: | 167.19 | | EINECS: | | | Product Categories: | Heterocycle-Pyrimidine series;pyrimidine | | Mol File: | 89487-99-0.mol |  |
| | 4-Hydroxy-2-(methylthio)pyrimidine-5-carbonitrile Chemical Properties |
| Melting point | 222-224℃ (isopropanol ) | | density | 1.42±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | Sealed in dry,Room Temperature | | pka | 5.38±0.50(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C6H5N3OS/c1-11-6-8-3-4(2-7)5(10)9-6/h3H,1H3,(H,8,9,10) | | InChIKey | XTLKENCFQIAAJK-UHFFFAOYSA-N | | SMILES | C1(SC)NC(=O)C(C#N)=CN=1 |
| | 4-Hydroxy-2-(methylthio)pyrimidine-5-carbonitrile Usage And Synthesis |
| Chemical Properties | White solid | | Synthesis | 2-Methyl-2-isothiourea (5 mmol) and ethyl ethoxycarbonylcyanoacetate (5 mmol) were dissolved in 20 mL of ethanol. Potassium carbonate (10 mmol) was added to the solution. The reaction mixture was refluxed for 48 hours, followed by cooling to room temperature and filtration. The filtrate was concentrated under reduced pressure and purified by column chromatography to afford 4-hydroxy-2-(methylthio)pyrimidine-5-carbonitrile in 65% yield. | | References | [1] Patent: US2008/255172, 2008, A1. Location in patent: Page/Page column 70 |
| | 4-Hydroxy-2-(methylthio)pyrimidine-5-carbonitrile Preparation Products And Raw materials |
|